Boltz: Boltz2AffinityPredictor Lab
About lab
One published Lab
Build with this Lab. Run it anywhere.
Use the same immutable release locally or through managed cloud execution, with its exact version and provenance preserved.
Preparing exact examples…
Multi-model lab with an embedded visualisation sibling for Boltz-2 affinity-focused protein-ligand predictions. Ships with a real protein/ligand pair so the lab runs out of the box on a GPU runner.
Manifest
{
"io": {
"inputs": [
{
"ui": {
"rows": 6,
"control": "textarea"
},
"name": "protein_sequence",
"label": "Target Protein Sequence",
"format": "sequence",
"maps_to": "boltz_boltz2_affinity_predictor.protein_sequence",
"required": false,
"value_type": "string",
"description": "Amino-acid sequence passed directly to the Boltz-2 protein input."
},
{
"ui": {
"rows": 3,
"control": "textarea"
},
"name": "ligand_smiles",
"label": "Ligand SMILES",
"format": "smiles",
"maps_to": "boltz_boltz2_affinity_predictor.ligand_smiles",
"required": false,
"value_type": "string",
"description": "Ligand structure encoded as a SMILES string and passed directly to Boltz-2."
},
{
"ui": {
"control": "file"
},
"file": {
"accept": [
".a3m",
".fasta",
".fa"
]
},
"name": "msa_path",
"label": "Precomputed MSA Path",
"format": "a3m",
"maps_to": "boltz_boltz2_affinity_predictor.msa_path",
"required": false,
"value_type": "file",
"description": "Optional path to a precomputed MSA file; leave unset when the MSA server is used."
},
{
"name": "use_msa_server",
"label": "Use MSA Server",
"default": true,
"maps_to": "boltz_boltz2_affinity_predictor.run_options.use_msa_server",
"value_type": "boolean",
"description": "Use Boltz's MSA server instead of requiring a precomputed MSA file."
},
{
"name": "sampling_steps",
"label": "Sampling Steps",
"default": 200,
"maps_to": "boltz_boltz2_affinity_predictor.run_options.sampling_steps",
"value_type": "integer",
"description": "Number of Boltz sampling steps for structure generation."
},
{
"name": "recycling_steps",
"label": "Recycling Steps",
"default": 3,
"maps_to": "boltz_boltz2_affinity_predictor.run_options.recycling_steps",
"value_type": "integer",
"description": "Number of structure recycling steps."
},
{
"name": "diffusion_samples",
"label": "Diffusion Samples",
"default": 1,
"maps_to": "boltz_boltz2_affinity_predictor.run_options.diffusion_samples",
"value_type": "integer",
"description": "Number of Boltz diffusion samples to generate."
},
{
"name": "output_format",
"label": "Output Format",
"default": "mmcif",
"maps_to": "boltz_boltz2_affinity_predictor.run_options.output_format",
"value_type": "string",
"description": "Structure artifact format emitted by Boltz.",
"allowed_values": [
"mmcif",
"pdb"
]
},
{
"ui": {
"rows": 6,
"control": "json"
},
"name": "run_options",
"label": "Boltz Run Options",
"format": "json",
"maps_to": "boltz_boltz2_affinity_predictor.run_options",
"advanced": true,
"required": false,
"value_type": "record",
"description": "Optional structured Boltz workflow controls such as MSA-server use, output format, and sampling settings."
}
],
"outputs": [
{
"name": "affinity_summary",
"label": "Affinity-Style Summary",
"maps_to": "boltz_boltz2_affinity_predictor.affinity_summary",
"description": "Parsed Boltz-2 affinity outputs, including binder probability and predicted affinity-like value when emitted."
},
{
"name": "confidence_summary",
"label": "Structure Confidence Summary",
"maps_to": "boltz_boltz2_affinity_predictor.confidence_summary",
"description": "Parsed Boltz-2 confidence outputs for the top-ranked predicted complex."
},
{
"name": "structure_artifacts",
"label": "Predicted Complex Structure Artifacts",
"maps_to": "boltz_boltz2_affinity_predictor.structure_artifacts",
"description": "File-backed structure artifacts, usually mmCIF, used by the 3D structure visualisation."
},
{
"name": "run_metadata",
"label": "Boltz Run Metadata",
"maps_to": "boltz_boltz2_affinity_predictor.run_metadata",
"description": "Runtime status, command metadata, logs, and caveats for the latest Boltz invocation."
}
]
},
"tags": [
"docking",
"boltz",
"structural-biology",
"protein-ligand",
"affinity",
"gpu"
],
"title": "Boltz: Boltz2AffinityPredictor Lab",
"models": [
{
"path": "models/core",
"alias": "boltz_boltz2_affinity_predictor",
"parameters": {
"override": true,
"accelerator": "gpu",
"runtime_mode": "managed",
"output_format": "mmcif",
"sampling_steps": 200,
"use_msa_server": true,
"recycling_steps": 3,
"diffusion_samples": 1,
"default_ligand_smiles": "N[C@@H](Cc1ccc(O)cc1)C(=O)O",
"default_protein_sequence": "MVTPEGNVSLVDESLLVGVTDEDRAVRSAHQFYERLIGLWAPAVMEAAHELGVFAALAEAPADSGELARRLDCDARAMRVLLDALYAYDVIDRIHDTNGFRYLLSAEARECLLPGTLFSLVGKFMHDINVAWPAWRNLAEVVRHGARDTSGAESPNGIAQEDYESLVGGINFWAPPIVTTLSRKLRASGRSGDATASVLDVGCGTGLYSQLLLREFPRWTATGLDVERIATLANAQALRLGVEERFATRAGDFWRGGWGTGYDLVLFANIFHLQTPASAVRLMRHAAACLAPDGLVAVVDQIVDADREPKTPQDRFALLFAASMTNTGGGDAYTFQEYEEWFTAAGLQRIETLDTPMHRILLARRATEPSAVPEGQASENLYFQ"
}
},
{
"path": "models/visualisation",
"alias": "visualisation",
"parameters": {
"integration_step": 0.01
}
}
],
"wiring": [
{
"to": [
"visualisation.boltz_boltz2_affinity_predictor_affinity_summary"
],
"from": "boltz_boltz2_affinity_predictor.affinity_summary"
},
{
"to": [
"visualisation.boltz_boltz2_affinity_predictor_confidence_summary"
],
"from": "boltz_boltz2_affinity_predictor.confidence_summary"
},
{
"to": [
"visualisation.boltz_boltz2_affinity_predictor_structure_artifacts"
],
"from": "boltz_boltz2_affinity_predictor.structure_artifacts"
},
{
"to": [
"visualisation.boltz_boltz2_affinity_predictor_run_metadata"
],
"from": "boltz_boltz2_affinity_predictor.run_metadata"
}
],
"package": "boltz-boltz2-affinity-predictor",
"runtime": {
"duration": 0.01,
"settle_steps": 1,
"initial_inputs": {},
"python_version": "3.10",
"communication_step": 0.01
},
"version": "1.0.0",
"description": "Multi-model lab with an embedded visualisation sibling for Boltz-2 affinity-focused protein-ligand predictions. Ships with a real protein/ligand pair so the lab runs out of the box on a GPU runner.",
"schema_version": "2.0"
}Runtime
Duration0.01
Comms Step0.01
Settle Steps1
Runs
Total1
Completed1
Failed0
Metadata
Packageboltz-boltz2-affinity-predictor
Created2026-05-03
Updated2026-06-13
dockingboltzstructural-biologyprotein-ligandaffinitygpuvisualisationother